C18H13Br2NO3S — CID 124667438
(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124667438) has the molecular formula C18H13Br2NO3S and a molecular weight of 483.18 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667438 |
| Molecular Formula | C18H13Br2NO3S |
| Molecular Weight | 483.18 g/mol |
| Exact Mass | 480.90 |
| IUPAC Name | (5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-3-[(2-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2/SC(=O)N(Cc3ccccc3Br)C2=O)cc1Br |
| InChI | InChI=1S/C18H13Br2NO3S/c1-24-15-7-6-11(8-14(15)20)9-16-17(22)21(18(23)25-16)10-12-4-2-3-5-13(12)19/h2-9H,10H2,1H3/b16-9+ |
| InChIKey | VBXWHLCXHJNYGJ-CXUHLZMHSA-N |
| XLogP | 5.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.18 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|