C22H16BrNO3S — CID 124667534
(5E)-3-[(2-bromophenyl)methyl]-5-[(4-methoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124667534) has the molecular formula C22H16BrNO3S and a molecular weight of 454.35 g/mol. Its IUPAC name is (5E)-3-[(2-bromophenyl)methyl]-5-[(4-methoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-bromophenyl)methyl]-5-[(4-methoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667534 |
| Molecular Formula | C22H16BrNO3S |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | (5E)-3-[(2-bromophenyl)methyl]-5-[(4-methoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2/SC(=O)N(Cc3ccccc3Br)C2=O)c2ccccc12 |
| InChI | InChI=1S/C22H16BrNO3S/c1-27-19-11-10-14(16-7-3-4-8-17(16)19)12-20-21(25)24(22(26)28-20)13-15-6-2-5-9-18(15)23/h2-12H,13H2,1H3/b20-12+ |
| InChIKey | VIZUBWJMHAGLDJ-UDWIEESQSA-N |
| XLogP | 5.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|