C19H15BrClNO4S — CID 2905873
5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2905873) has the molecular formula C19H15BrClNO4S and a molecular weight of 468.76 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2905873 |
| Molecular Formula | C19H15BrClNO4S |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(OC)c(C=C2SC(=O)N(Cc3ccccc3Cl)C2=O)cc1Br |
| InChI | InChI=1S/C19H15BrClNO4S/c1-25-15-9-16(26-2)13(20)7-12(15)8-17-18(23)22(19(24)27-17)10-11-5-3-4-6-14(11)21/h3-9H,10H2,1-2H3 |
| InChIKey | OLRDQWDTVCETKV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|