C15H12BrNO4S — CID 2913856
5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 2913856) has the molecular formula C15H12BrNO4S and a molecular weight of 382.24 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2913856 |
| Molecular Formula | C15H12BrNO4S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)SC(=Cc2cc(Br)c(OC)cc2OC)C1=O |
| InChI | InChI=1S/C15H12BrNO4S/c1-4-5-17-14(18)13(22-15(17)19)7-9-6-10(16)12(21-3)8-11(9)20-2/h1,6-8H,5H2,2-3H3 |
| InChIKey | RHQOGNCPTVZTLF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|