C19H16BrNO4S — CID 1344655
(5Z)-3-benzyl-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1344655) has the molecular formula C19H16BrNO4S and a molecular weight of 434.31 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1344655 |
| Molecular Formula | C19H16BrNO4S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | (5Z)-3-benzyl-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(OC)c(/C=C2\SC(=O)N(Cc3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C19H16BrNO4S/c1-24-15-10-16(25-2)14(20)8-13(15)9-17-18(22)21(19(23)26-17)11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3/b17-9- |
| InChIKey | YPWZZPDMYMJDRO-MFOYZWKCSA-N |
| XLogP | 4.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|