C28H25NO5S — CID 2911130
5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2911130) has the molecular formula C28H25NO5S and a molecular weight of 487.58 g/mol. Its IUPAC name is 5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2911130 |
| Molecular Formula | C28H25NO5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2SC(=O)N(CC(=O)c3ccc(C)cc3)C2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H25NO5S/c1-3-33-25-15-21(11-14-24(25)34-18-20-7-5-4-6-8-20)16-26-27(31)29(28(32)35-26)17-23(30)22-12-9-19(2)10-13-22/h4-16H,3,17-18H2,1-2H3 |
| InChIKey | KPOCUKQWTSRBFC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|