C27H23NO5S — CID 126230945
(5E)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126230945) has the molecular formula C27H23NO5S and a molecular weight of 473.55 g/mol. Its IUPAC name is (5E)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126230945 |
| Molecular Formula | C27H23NO5S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (5E)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)c3ccccc3)C2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C27H23NO5S/c1-18-8-10-19(11-9-18)17-33-23-13-12-20(14-24(23)32-2)15-25-26(30)28(27(31)34-25)16-22(29)21-6-4-3-5-7-21/h3-15H,16-17H2,1-2H3/b25-15+ |
| InChIKey | MFMNYBNQKGFRCN-MFKUBSTISA-N |
| XLogP | 5.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|