C22H19BrN2O6S — CID 126224888
2-[4-[(Z)-[3-[2-(4-bromophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 126224888) has the molecular formula C22H19BrN2O6S and a molecular weight of 519.37 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-[2-(4-bromophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[3-[2-(4-bromophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126224888 |
| Molecular Formula | C22H19BrN2O6S |
| Molecular Weight | 519.37 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 2-[4-[(Z)-[3-[2-(4-bromophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)c3ccc(Br)cc3)C2=O)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H19BrN2O6S/c1-2-30-18-9-13(3-8-17(18)31-12-20(24)27)10-19-21(28)25(22(29)32-19)11-16(26)14-4-6-15(23)7-5-14/h3-10H,2,11-12H2,1H3,(H2,24,27)/b19-10- |
| InChIKey | JSOKSAVYNWIZDT-GRSHGNNSSA-N |
| XLogP | 3.63 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|