C26H26N2O7S — CID 126393718
4-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126393718) has the molecular formula C26H26N2O7S and a molecular weight of 510.57 g/mol. Its IUPAC name is 4-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126393718 |
| Molecular Formula | C26H26N2O7S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 4-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)N3CCCCC3)C2=O)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N2O7S/c1-34-21-13-18(7-10-20(21)35-16-17-5-8-19(9-6-17)25(31)32)14-22-24(30)28(26(33)36-22)15-23(29)27-11-3-2-4-12-27/h5-10,13-14H,2-4,11-12,15-16H2,1H3,(H,31,32)/b22-14- |
| InChIKey | ZOLBALFSFNDGLL-HMAPJEAMSA-N |
| XLogP | 4.02 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|