C26H25IN2O6S — CID 3646540
4-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid (PubChem CID 3646540) has the molecular formula C26H25IN2O6S and a molecular weight of 620.47 g/mol. Its IUPAC name is 4-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3646540 |
| Molecular Formula | C26H25IN2O6S |
| Molecular Weight | 620.47 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 4-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(C=C3SC(=O)N(CC(=O)N4CCCCCC4)C3=O)cc2I)cc1 |
| InChI | InChI=1S/C26H25IN2O6S/c27-20-13-18(7-10-21(20)35-16-17-5-8-19(9-6-17)25(32)33)14-22-24(31)29(26(34)36-22)15-23(30)28-11-3-1-2-4-12-28/h5-10,13-14H,1-4,11-12,15-16H2,(H,32,33) |
| InChIKey | OFQQLPBTFCGDTH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|