C27H21IN2O6S — CID 6038764
4-[[2-iodo-4-[(E)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 6038764) has the molecular formula C27H21IN2O6S and a molecular weight of 628.44 g/mol. Its IUPAC name is 4-[[2-iodo-4-[(E)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-iodo-4-[(E)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 6038764 |
| Molecular Formula | C27H21IN2O6S |
| Molecular Weight | 628.44 g/mol |
| Exact Mass | 628.02 |
| IUPAC Name | 4-[[2-iodo-4-[(E)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCc4ccc(C(=O)O)cc4)c(I)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H21IN2O6S/c1-16-2-9-20(10-3-16)29-24(31)14-30-25(32)23(37-27(30)35)13-18-6-11-22(21(28)12-18)36-15-17-4-7-19(8-5-17)26(33)34/h2-13H,14-15H2,1H3,(H,29,31)(H,33,34)/b23-13+ |
| InChIKey | XUNNPBAMIRQCRW-YDZHTSKRSA-N |
| XLogP | 5.55 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|