C29H27IN2O4S — CID 3381299
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3381299) has the molecular formula C29H27IN2O4S and a molecular weight of 626.52 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3381299 |
| Molecular Formula | C29H27IN2O4S |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 626.07 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(OCc3ccc4ccccc4c3)c(I)c2)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C29H27IN2O4S/c30-24-16-20(10-12-25(24)36-19-21-9-11-22-7-3-4-8-23(22)15-21)17-26-28(34)32(29(35)37-26)18-27(33)31-13-5-1-2-6-14-31/h3-4,7-12,15-17H,1-2,5-6,13-14,18-19H2 |
| InChIKey | RZWMTAZXEPGIGD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|