C21H23IN2O6S — CID 126391423
ethyl 2-[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate (PubChem CID 126391423) has the molecular formula C21H23IN2O6S and a molecular weight of 558.39 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126391423 |
| Molecular Formula | C21H23IN2O6S |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2\SC(=O)N(CC(=O)N3CCCCC3)C2=O)cc1I |
| InChI | InChI=1S/C21H23IN2O6S/c1-2-29-19(26)13-30-16-7-6-14(10-15(16)22)11-17-20(27)24(21(28)31-17)12-18(25)23-8-4-3-5-9-23/h6-7,10-11H,2-5,8-9,12-13H2,1H3/b17-11- |
| InChIKey | OAMKWJYMFYSKRJ-BOPFTXTBSA-N |
| XLogP | 3.28 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|