C17H14INO5S — CID 126051244
ethyl 2-[(5E)-5-[(3-iodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126051244) has the molecular formula C17H14INO5S and a molecular weight of 471.27 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[(3-iodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[(3-iodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126051244 |
| Molecular Formula | C17H14INO5S |
| Molecular Weight | 471.27 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | ethyl 2-[(5E)-5-[(3-iodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | C#CCOc1ccc(/C=C2/SC(=O)N(CC(=O)OCC)C2=O)cc1I |
| InChI | InChI=1S/C17H14INO5S/c1-3-7-24-13-6-5-11(8-12(13)18)9-14-16(21)19(17(22)25-14)10-15(20)23-4-2/h1,5-6,8-9H,4,7,10H2,2H3/b14-9+ |
| InChIKey | DLNFDDFJOZYPQW-NTEUORMPSA-N |
| XLogP | 2.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|