C25H25IN2O4S — CID 3634463
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3634463) has the molecular formula C25H25IN2O4S and a molecular weight of 576.46 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3634463 |
| Molecular Formula | C25H25IN2O4S |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccccc2OCc2ccc(I)cc2)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C25H25IN2O4S/c26-20-11-9-18(10-12-20)17-32-21-8-4-3-7-19(21)15-22-24(30)28(25(31)33-22)16-23(29)27-13-5-1-2-6-14-27/h3-4,7-12,15H,1-2,5-6,13-14,16-17H2 |
| InChIKey | FIOIXMWHLLOOAY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|