C27H23IN2O5S — CID 126145947
(5E)-5-[[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126145947) has the molecular formula C27H23IN2O5S and a molecular weight of 614.46 g/mol. Its IUPAC name is (5E)-5-[[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126145947 |
| Molecular Formula | C27H23IN2O5S |
| Molecular Weight | 614.46 g/mol |
| Exact Mass | 614.04 |
| IUPAC Name | (5E)-5-[[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(OCc3cccc4ccccc34)c(I)c2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C27H23IN2O5S/c28-22-14-18(8-9-23(22)35-17-20-6-3-5-19-4-1-2-7-21(19)20)15-24-26(32)30(27(33)36-24)16-25(31)29-10-12-34-13-11-29/h1-9,14-15H,10-13,16-17H2/b24-15+ |
| InChIKey | CNTMVZVMSBBBPM-BUVRLJJBSA-N |
| XLogP | 4.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|