C21H24INO8S — CID 126207909
[(2R)-butan-2-yl] 2-[(5E)-5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126207909) has the molecular formula C21H24INO8S and a molecular weight of 577.39 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5E)-5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126207909 |
| Molecular Formula | C21H24INO8S |
| Molecular Weight | 577.39 g/mol |
| Exact Mass | 577.03 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[4-(2-ethoxy-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/SC(=O)N(CC(=O)O[C@H](C)CC)C2=O)cc1OC |
| InChI | InChI=1S/C21H24INO8S/c1-5-12(3)31-17(24)10-23-20(26)16(32-21(23)27)9-13-7-14(22)19(15(8-13)28-4)30-11-18(25)29-6-2/h7-9,12H,5-6,10-11H2,1-4H3/b16-9+/t12-/m1/s1 |
| InChIKey | XHSYXNHNRFDYGU-GFQQVXNGSA-N |
| XLogP | 3.62 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|