C19H14INO5S — CID 1334389
(5Z)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 1334389) has the molecular formula C19H14INO5S and a molecular weight of 495.29 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1334389 |
| Molecular Formula | C19H14INO5S |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)c3ccccc3)C2=O)cc(I)c1O |
| InChI | InChI=1S/C19H14INO5S/c1-26-15-8-11(7-13(20)17(15)23)9-16-18(24)21(19(25)27-16)10-14(22)12-5-3-2-4-6-12/h2-9,23H,10H2,1H3/b16-9- |
| InChIKey | ZGIFPRYWWKQUTH-SXGWCWSVSA-N |
| XLogP | 3.92 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|