C18H12N2O5S — CID 18847894
(5Z)-5-[(3-nitrophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 18847894) has the molecular formula C18H12N2O5S and a molecular weight of 368.37 g/mol. Its IUPAC name is (5Z)-5-[(3-nitrophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18847894 |
| Molecular Formula | C18H12N2O5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cccc([N+](=O)[O-])c2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C18H12N2O5S/c21-15(13-6-2-1-3-7-13)11-19-17(22)16(26-18(19)23)10-12-5-4-8-14(9-12)20(24)25/h1-10H,11H2/b16-10- |
| InChIKey | DTWIZENHMCVKGA-YBEGLDIGSA-N |
| XLogP | 3.51 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|