C15H14N2O6S — CID 124642179
propan-2-yl 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124642179) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124642179 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C15H14N2O6S/c1-9(2)23-13(18)8-16-14(19)12(24-15(16)20)7-10-4-3-5-11(6-10)17(21)22/h3-7,9H,8H2,1-2H3/b12-7+ |
| InChIKey | ZIALNKQXJRROJY-KPKJPENVSA-N |
| XLogP | 2.58 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|