C15H14INO4S — CID 4038084
propan-2-yl 2-[5-[(3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 4038084) has the molecular formula C15H14INO4S and a molecular weight of 431.25 g/mol. Its IUPAC name is propan-2-yl 2-[5-[(3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[5-[(3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 4038084 |
| Molecular Formula | C15H14INO4S |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | propan-2-yl 2-[5-[(3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)SC(=Cc2cccc(I)c2)C1=O |
| InChI | InChI=1S/C15H14INO4S/c1-9(2)21-13(18)8-17-14(19)12(22-15(17)20)7-10-4-3-5-11(16)6-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | LTRSVQVRICAMPS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|