C19H24N2O4S — CID 1228022
propan-2-yl 2-[(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 1228022) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is propan-2-yl 2-[(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1228022 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | propan-2-yl 2-[(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCN(CC)c1ccc(/C=C2\SC(=O)N(CC(=O)OC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-5-20(6-2)15-9-7-14(8-10-15)11-16-18(23)21(19(24)26-16)12-17(22)25-13(3)4/h7-11,13H,5-6,12H2,1-4H3/b16-11- |
| InChIKey | NCWYDSBHJBOROP-WJDWOHSUSA-N |
| XLogP | 3.52 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|