C15H14BrNO5S — CID 124642076
propan-2-yl 2-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124642076) has the molecular formula C15H14BrNO5S and a molecular weight of 400.25 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124642076 |
| Molecular Formula | C15H14BrNO5S |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2ccc(O)c(Br)c2)C1=O |
| InChI | InChI=1S/C15H14BrNO5S/c1-8(2)22-13(19)7-17-14(20)12(23-15(17)21)6-9-3-4-11(18)10(16)5-9/h3-6,8,18H,7H2,1-2H3/b12-6+ |
| InChIKey | VXKHKOFLFHVUQH-WUXMJOGZSA-N |
| XLogP | 3.14 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|