C16H15BrFNO4S — CID 126206714
[(2S)-butan-2-yl] 2-[(5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126206714) has the molecular formula C16H15BrFNO4S and a molecular weight of 416.27 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 2-[(5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2S)-butan-2-yl] 2-[(5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126206714 |
| Molecular Formula | C16H15BrFNO4S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | [(2S)-butan-2-yl] 2-[(5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@H](C)OC(=O)CN1C(=O)S/C(=C/c2ccc(F)c(Br)c2)C1=O |
| InChI | InChI=1S/C16H15BrFNO4S/c1-3-9(2)23-14(20)8-19-15(21)13(24-16(19)22)7-10-4-5-12(18)11(17)6-10/h4-7,9H,3,8H2,1-2H3/b13-7+/t9-/m0/s1 |
| InChIKey | HPIGUKGERNXJMD-PBJWJZLWSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|