C23H21ClFNO5S — CID 126218016
[(2S)-butan-2-yl] 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126218016) has the molecular formula C23H21ClFNO5S and a molecular weight of 477.94 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2S)-butan-2-yl] 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126218016 |
| Molecular Formula | C23H21ClFNO5S |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | [(2S)-butan-2-yl] 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@H](C)OC(=O)CN1C(=O)S/C(=C/c2cccc(OCc3c(F)cccc3Cl)c2)C1=O |
| InChI | InChI=1S/C23H21ClFNO5S/c1-3-14(2)31-21(27)12-26-22(28)20(32-23(26)29)11-15-6-4-7-16(10-15)30-13-17-18(24)8-5-9-19(17)25/h4-11,14H,3,12-13H2,1-2H3/b20-11+/t14-/m0/s1 |
| InChIKey | OQRBVAXTUPGNLD-HXJASHHUSA-N |
| XLogP | 5.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|