C25H22ClFN2O4S — CID 126212076
[(2R)-butan-2-yl] 2-[(5E)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126212076) has the molecular formula C25H22ClFN2O4S and a molecular weight of 500.98 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5E)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126212076 |
| Molecular Formula | C25H22ClFN2O4S |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@@H](C)OC(=O)CN1C(=O)S/C(=C/c2cn(Cc3c(F)cccc3Cl)c3ccccc23)C1=O |
| InChI | InChI=1S/C25H22ClFN2O4S/c1-3-15(2)33-23(30)14-29-24(31)22(34-25(29)32)11-16-12-28(21-10-5-4-7-17(16)21)13-18-19(26)8-6-9-20(18)27/h4-12,15H,3,13-14H2,1-2H3/b22-11+/t15-/m1/s1 |
| InChIKey | KUXZWJWEGYNYAR-XHADFYDMSA-N |
| XLogP | 5.86 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|