C27H17BrClFN2O3S — CID 126140591
(5Z)-5-[[5-bromo-1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126140591) has the molecular formula C27H17BrClFN2O3S and a molecular weight of 583.87 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126140591 |
| Molecular Formula | C27H17BrClFN2O3S |
| Molecular Weight | 583.87 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cn(Cc3c(F)cccc3Cl)c3ccc(Br)cc23)C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H17BrClFN2O3S/c28-18-9-10-23-19(12-18)17(13-31(23)14-20-21(29)7-4-8-22(20)30)11-25-26(34)32(27(35)36-25)15-24(33)16-5-2-1-3-6-16/h1-13H,14-15H2/b25-11- |
| InChIKey | NSGMKEMUUQIKOZ-GATIEOLUSA-N |
| XLogP | 7.16 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.87 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|