C26H22BrN3O5S — CID 126140058
(5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126140058) has the molecular formula C26H22BrN3O5S and a molecular weight of 568.45 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126140058 |
| Molecular Formula | C26H22BrN3O5S |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cn(CC(=O)N3CCOCC3)c3ccc(Br)cc23)C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H22BrN3O5S/c27-19-6-7-21-20(13-19)18(14-29(21)16-24(32)28-8-10-35-11-9-28)12-23-25(33)30(26(34)36-23)15-22(31)17-4-2-1-3-5-17/h1-7,12-14H,8-11,15-16H2/b23-12- |
| InChIKey | RLRXDXYEWWIGLU-FMCGGJTJSA-N |
| XLogP | 4.18 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|