C25H22BrN3O4S — CID 126135910
(5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126135910) has the molecular formula C25H22BrN3O4S and a molecular weight of 540.44 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126135910 |
| Molecular Formula | C25H22BrN3O4S |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)S/C(=C\c3cn(CC(=O)N4CCOCC4)c4ccc(Br)cc34)C2=O)cc1 |
| InChI | InChI=1S/C25H22BrN3O4S/c1-16-2-5-19(6-3-16)29-24(31)22(34-25(29)32)12-17-14-28(21-7-4-18(26)13-20(17)21)15-23(30)27-8-10-33-11-9-27/h2-7,12-14H,8-11,15H2,1H3/b22-12- |
| InChIKey | UUTWCRNJVKZVLR-UUYOSTAYSA-N |
| XLogP | 4.81 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|