C21H15BrN2O4S — CID 126131299
methyl 2-[5-bromo-3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate (PubChem CID 126131299) has the molecular formula C21H15BrN2O4S and a molecular weight of 471.33 g/mol. Its IUPAC name is methyl 2-[5-bromo-3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 126131299 |
| Molecular Formula | C21H15BrN2O4S |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | methyl 2-[5-bromo-3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(/C=C2\SC(=O)N(c3ccccc3)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H15BrN2O4S/c1-28-19(25)12-23-11-13(16-10-14(22)7-8-17(16)23)9-18-20(26)24(21(27)29-18)15-5-3-2-4-6-15/h2-11H,12H2,1H3/b18-9- |
| InChIKey | IKDUXPBMUPLZHO-NVMNQCDNSA-N |
| XLogP | 4.82 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|