C26H18BrFN2O2S — CID 126134305
(5Z)-5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126134305) has the molecular formula C26H18BrFN2O2S and a molecular weight of 521.41 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126134305 |
| Molecular Formula | C26H18BrFN2O2S |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)S/C(=C\c3cn(Cc4ccccc4F)c4ccc(Br)cc34)C2=O)cc1 |
| InChI | InChI=1S/C26H18BrFN2O2S/c1-16-6-9-20(10-7-16)30-25(31)24(33-26(30)32)12-18-15-29(14-17-4-2-3-5-22(17)28)23-11-8-19(27)13-21(18)23/h2-13,15H,14H2,1H3/b24-12- |
| InChIKey | RFWSVPJRDSPHPD-MSXFZWOLSA-N |
| XLogP | 7.14 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|