C27H21BrFN3O2S — CID 4583647
5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 4583647) has the molecular formula C27H21BrFN3O2S and a molecular weight of 550.45 g/mol. Its IUPAC name is 5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4583647 |
| Molecular Formula | C27H21BrFN3O2S |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 5-[[5-bromo-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2/SC(=Cc3cn(Cc4ccccc4F)c4ccc(Br)cc34)C(=O)N2C)cc1 |
| InChI | InChI=1S/C27H21BrFN3O2S/c1-31-26(33)25(35-27(31)30-20-8-10-21(34-2)11-9-20)13-18-16-32(15-17-5-3-4-6-23(17)29)24-12-7-19(28)14-22(18)24/h3-14,16H,15H2,1-2H3/b25-13?,30-27+ |
| InChIKey | GKPJZEOQIRYDGO-IDSUXWGASA-N |
| XLogP | 6.83 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|