C27H24N4O4S — CID 1233260
N-(furan-2-ylmethyl)-2-[3-[[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 1233260) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[3-[[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[3-[[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 1233260 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[3-[[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | COc1ccc(/N=C2/SC(=Cc3cn(CC(=O)NCc4ccco4)c4ccccc34)C(=O)N2C)cc1 |
| InChI | InChI=1S/C27H24N4O4S/c1-30-26(33)24(36-27(30)29-19-9-11-20(34-2)12-10-19)14-18-16-31(23-8-4-3-7-22(18)23)17-25(32)28-15-21-6-5-13-35-21/h3-14,16H,15,17H2,1-2H3,(H,28,32)/b24-14?,29-27+ |
| InChIKey | DYWJCHUXCPBYOV-DIIRKOFPSA-N |
| XLogP | 4.79 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|