C25H19N3O4S — CID 5024109
2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetic acid (PubChem CID 5024109) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 5024109 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C=C2S/C(=N\c3ccccc3)N(Cc3ccco3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H19N3O4S/c29-23(30)16-27-14-17(20-10-4-5-11-21(20)27)13-22-24(31)28(15-19-9-6-12-32-19)25(33-22)26-18-7-2-1-3-8-18/h1-14H,15-16H2,(H,29,30)/b22-13?,26-25- |
| InChIKey | DIBKSAGYUSSPQZ-PISSCQFASA-N |
| XLogP | 5.12 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|