C23H22N4O2S — CID 4310912
2-[3-[(4-oxo-2-phenylimino-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 4310912) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[3-[(4-oxo-2-phenylimino-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[(4-oxo-2-phenylimino-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 4310912 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[3-[(4-oxo-2-phenylimino-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | CCCN1C(=O)C(=Cc2cn(CC(N)=O)c3ccccc23)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C23H22N4O2S/c1-2-12-27-22(29)20(30-23(27)25-17-8-4-3-5-9-17)13-16-14-26(15-21(24)28)19-11-7-6-10-18(16)19/h3-11,13-14H,2,12,15H2,1H3,(H2,24,28)/b20-13?,25-23+ |
| InChIKey | XXONANCTCMMXGT-QWPXWSPQSA-N |
| XLogP | 4.14 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|