C24H22N4O2S — CID 4209861
2-[3-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile (PubChem CID 4209861) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[3-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[3-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 4209861 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[3-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile |
| SMILES | COCCCN1C(=O)C(=Cc2cn(CC#N)c3ccccc23)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C24H22N4O2S/c1-30-15-7-13-28-23(29)22(31-24(28)26-19-8-3-2-4-9-19)16-18-17-27(14-12-25)21-11-6-5-10-20(18)21/h2-6,8-11,16-17H,7,13-15H2,1H3/b22-16?,26-24+ |
| InChIKey | RVMLMOZAWNALIG-HYKFYOIBSA-N |
| XLogP | 4.81 |
| TPSA | 70.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|