C25H27N3O3S — CID 5194412
3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 5194412) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5194412 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)C(=Cc2cn(C(C)C)c3ccccc23)S/C1=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H27N3O3S/c1-17(2)28-16-18(21-7-5-6-8-22(21)28)15-23-24(29)27(13-14-30-3)25(32-23)26-19-9-11-20(31-4)12-10-19/h5-12,15-17H,13-14H2,1-4H3/b23-15?,26-25+ |
| InChIKey | CFFJQCHIQBJBOM-GSRCSIRLSA-N |
| XLogP | 5.48 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|