C25H27N3O2S — CID 126245095
(5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126245095) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is (5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126245095 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CC[C@H](C)n1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)N(CC)C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H27N3O2S/c1-5-17(3)28-16-18(21-9-7-8-10-22(21)28)15-23-24(29)27(6-2)25(31-23)26-19-11-13-20(30-4)14-12-19/h7-17H,5-6H2,1-4H3/b23-15+,26-25-/t17-/m0/s1 |
| InChIKey | MCUDAHQPKPQOFY-ZUTMNQQBSA-N |
| XLogP | 6.24 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|