C27H21ClFN3OS — CID 126234384
(5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126234384) has the molecular formula C27H21ClFN3OS and a molecular weight of 490.00 g/mol. Its IUPAC name is (5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126234384 |
| Molecular Formula | C27H21ClFN3OS |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | (5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cn(Cc3ccc(Cl)cc3)c3ccccc23)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C27H21ClFN3OS/c1-2-32-26(33)25(34-27(32)30-22-13-11-21(29)12-14-22)15-19-17-31(24-6-4-3-5-23(19)24)16-18-7-9-20(28)10-8-18/h3-15,17H,2,16H2,1H3/b25-15+,30-27- |
| InChIKey | VPDOXQGJBFUMKH-MNMIYWSCSA-N |
| XLogP | 7.11 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|