C28H22ClN3O3S — CID 126059773
4-[[(5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 126059773) has the molecular formula C28H22ClN3O3S and a molecular weight of 516.02 g/mol. Its IUPAC name is 4-[[(5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[(5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 126059773 |
| Molecular Formula | C28H22ClN3O3S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 4-[[(5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2cn(Cc3ccccc3Cl)c3ccccc23)S/C1=N\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H22ClN3O3S/c1-2-32-26(33)25(36-28(32)30-21-13-11-18(12-14-21)27(34)35)15-20-17-31(24-10-6-4-8-22(20)24)16-19-7-3-5-9-23(19)29/h3-15,17H,2,16H2,1H3,(H,34,35)/b25-15+,30-28- |
| InChIKey | JHNKNDGQMFFVGT-GSYGROADSA-N |
| XLogP | 6.67 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|