C30H25Cl2N3O3S — CID 3600834
ethyl 3-[[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 3600834) has the molecular formula C30H25Cl2N3O3S and a molecular weight of 578.52 g/mol. Its IUPAC name is ethyl 3-[[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3600834 |
| Molecular Formula | C30H25Cl2N3O3S |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | ethyl 3-[[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2/SC(=Cc3cn(Cc4ccc(Cl)cc4Cl)c4ccccc34)C(=O)N2CC)c1 |
| InChI | InChI=1S/C30H25Cl2N3O3S/c1-3-35-28(36)27(39-30(35)33-23-9-7-8-19(14-23)29(37)38-4-2)15-21-18-34(26-11-6-5-10-24(21)26)17-20-12-13-22(31)16-25(20)32/h5-16,18H,3-4,17H2,1-2H3/b27-15?,33-30+ |
| InChIKey | MNSGGWKDDQKFIP-SRZAQDAZSA-N |
| XLogP | 7.80 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|