C31H27Cl2N3OS — CID 98105743
(5Z)-3-cyclohexyl-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 98105743) has the molecular formula C31H27Cl2N3OS and a molecular weight of 560.55 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98105743 |
| Molecular Formula | C31H27Cl2N3OS |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)S/C(=N\c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C31H27Cl2N3OS/c32-23-16-15-21(27(33)18-23)19-35-20-22(26-13-7-8-14-28(26)35)17-29-30(37)36(25-11-5-2-6-12-25)31(38-29)34-24-9-3-1-4-10-24/h1,3-4,7-10,13-18,20,25H,2,5-6,11-12,19H2/b29-17-,34-31- |
| InChIKey | BWYUKPFJXRRMRM-QHYMBCHSSA-N |
| XLogP | 8.93 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|