C31H35N3OS — CID 5025668
5-[(1-benzylindol-3-yl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one (PubChem CID 5025668) has the molecular formula C31H35N3OS and a molecular weight of 497.71 g/mol. Its IUPAC name is 5-[(1-benzylindol-3-yl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(1-benzylindol-3-yl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5025668 |
| Molecular Formula | C31H35N3OS |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 5-[(1-benzylindol-3-yl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cn(Cc3ccccc3)c3ccccc23)S/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C31H35N3OS/c35-30-29(36-31(32-25-14-6-2-7-15-25)34(30)26-16-8-3-9-17-26)20-24-22-33(21-23-12-4-1-5-13-23)28-19-11-10-18-27(24)28/h1,4-5,10-13,18-20,22,25-26H,2-3,6-9,14-17,21H2/b29-20?,32-31- |
| InChIKey | RHUBRIDAQSCWAK-HUQVOIRDSA-N |
| XLogP | 7.63 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|