C28H35N3O3S — CID 3917280
ethyl 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate (PubChem CID 3917280) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is ethyl 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 3917280 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | ethyl 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C28H35N3O3S/c1-2-34-26(32)19-30-18-20(23-15-9-10-16-24(23)30)17-25-27(33)31(22-13-7-4-8-14-22)28(35-25)29-21-11-5-3-6-12-21/h9-10,15-18,21-22H,2-8,11-14,19H2,1H3/b25-17?,29-28- |
| InChIKey | BEEZLMYSOITFGQ-FPGMDTKZSA-N |
| XLogP | 6.14 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|