C26H30N4OS — CID 5186244
2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetonitrile (PubChem CID 5186244) has the molecular formula C26H30N4OS and a molecular weight of 446.62 g/mol. Its IUPAC name is 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 5186244 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[3-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetonitrile |
| SMILES | N#CCn1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C26H30N4OS/c27-15-16-29-18-19(22-13-7-8-14-23(22)29)17-24-25(31)30(21-11-5-2-6-12-21)26(32-24)28-20-9-3-1-4-10-20/h7-8,13-14,17-18,20-21H,1-6,9-12,16H2/b24-17?,28-26- |
| InChIKey | WSWYJFNRPPEDKV-AQXNVXIFSA-N |
| XLogP | 6.10 |
| TPSA | 61.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|