C21H28N2OS2 — CID 3946456
3-cyclohexyl-2-cyclohexylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 3946456) has the molecular formula C21H28N2OS2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3946456 |
| Molecular Formula | C21H28N2OS2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccsc1C=C1S/C(=N\C2CCCCC2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C21H28N2OS2/c1-15-12-13-25-18(15)14-19-20(24)23(17-10-6-3-7-11-17)21(26-19)22-16-8-4-2-5-9-16/h12-14,16-17H,2-11H2,1H3/b19-14?,22-21- |
| InChIKey | VXGCVFRSKUKYFY-UCADKZSTSA-N |
| XLogP | 5.99 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|