C30H44N2O2S — CID 3289532
3-cyclohexyl-2-cyclohexylimino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 3289532) has the molecular formula C30H44N2O2S and a molecular weight of 496.76 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3289532 |
| Molecular Formula | C30H44N2O2S |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H44N2O2S/c1-29(2,3)23-17-20(18-24(26(23)33)30(4,5)6)19-25-27(34)32(22-15-11-8-12-16-22)28(35-25)31-21-13-9-7-10-14-21/h17-19,21-22,33H,7-16H2,1-6H3/b25-19?,31-28- |
| InChIKey | ASTLKRWXECIQEF-VQTMMVLZSA-N |
| XLogP | 7.92 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|