C24H28I2N2O4S — CID 6082139
2-[4-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid (PubChem CID 6082139) has the molecular formula C24H28I2N2O4S and a molecular weight of 694.37 g/mol. Its IUPAC name is 2-[4-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid |
|---|---|
| PubChem CID | 6082139 |
| Molecular Formula | C24H28I2N2O4S |
| Molecular Weight | 694.37 g/mol |
| Exact Mass | 693.99 |
| IUPAC Name | 2-[4-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(I)cc(/C=C2\S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)cc1I |
| InChI | InChI=1S/C24H28I2N2O4S/c25-18-11-15(12-19(26)22(18)32-14-21(29)30)13-20-23(31)28(17-9-5-2-6-10-17)24(33-20)27-16-7-3-1-4-8-16/h11-13,16-17H,1-10,14H2,(H,29,30)/b20-13-,27-24- |
| InChIKey | LYUPTKVVGKEUNL-CXEDADEWSA-N |
| XLogP | 6.30 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|