C32H36IN3O3S — CID 3617518
2-[[4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile (PubChem CID 3617518) has the molecular formula C32H36IN3O3S and a molecular weight of 669.63 g/mol. Its IUPAC name is 2-[[4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 3617518 |
| Molecular Formula | C32H36IN3O3S |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | 2-[[4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C32H36IN3O3S/c1-2-38-28-18-22(17-27(33)30(28)39-21-24-12-10-9-11-23(24)20-34)19-29-31(37)36(26-15-7-4-8-16-26)32(40-29)35-25-13-5-3-6-14-25/h9-12,17-19,25-26H,2-8,13-16,21H2,1H3/b29-19?,35-32- |
| InChIKey | NQMMEXFIXQFLPO-FAFXTHBESA-N |
| XLogP | 8.08 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|