C32H31N3O3S — CID 98077820
2-[[4-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 98077820) has the molecular formula C32H31N3O3S and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[[4-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 98077820 |
| Molecular Formula | C32H31N3O3S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-[[4-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccccc3)N(C3CCCCC3)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C32H31N3O3S/c1-2-37-29-19-23(17-18-28(29)38-22-25-12-10-9-11-24(25)21-33)20-30-31(36)35(27-15-7-4-8-16-27)32(39-30)34-26-13-5-3-6-14-26/h3,5-6,9-14,17-20,27H,2,4,7-8,15-16,22H2,1H3/b30-20+,34-32- |
| InChIKey | JITDQZSRGHTGNX-HDSDKQTKSA-N |
| XLogP | 7.47 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|